C25H29FN4O — CID 141348526
N-[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 141348526) has the molecular formula C25H29FN4O and a molecular weight of 420.53 g/mol. Its IUPAC name is N-[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141348526 |
| Molecular Formula | C25H29FN4O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CN(C)C(c1cccc(F)c1)C1CCC(NC(=O)c2cc(-c3ccccc3)n[nH]2)CC1 |
| InChI | InChI=1S/C25H29FN4O/c1-30(2)24(19-9-6-10-20(26)15-19)18-11-13-21(14-12-18)27-25(31)23-16-22(28-29-23)17-7-4-3-5-8-17/h3-10,15-16,18,21,24H,11-14H2,1-2H3,(H,27,31)(H,28,29) |
| InChIKey | QRAFNCDGTMBXSW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |