C17H21N3O — CID 8889054
N-[(1R,2R)-2-methylcyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 8889054) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 8889054 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C17H21N3O/c1-12-7-5-6-10-14(12)18-17(21)16-11-15(19-20-16)13-8-3-2-4-9-13/h2-4,8-9,11-12,14H,5-7,10H2,1H3,(H,18,21)(H,19,20)/t12-,14-/m1/s1 |
| InChIKey | VFDUAHHGVJZVNN-TZMCWYRMSA-N |
| XLogP | 3.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |