C10H15N3O — CID 59304482
N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrazole-5-carboxamide (PubChem CID 59304482) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59304482 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrazole-5-carboxamide |
| SMILES | C[C@H]1CCC[C@@H]1NC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H15N3O/c1-7-3-2-4-8(7)12-10(14)9-5-6-11-13-9/h5-8H,2-4H2,1H3,(H,11,13)(H,12,14)/t7-,8-/m0/s1 |
| InChIKey | KXUZELNIZIJLDQ-YUMQZZPRSA-N |
| XLogP | 1.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |