C11H18N4O — CID 141156891
N-(2,6-dimethylpiperidin-1-yl)-1H-pyrazole-5-carboxamide (PubChem CID 141156891) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N-(2,6-dimethylpiperidin-1-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2,6-dimethylpiperidin-1-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141156891 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-(2,6-dimethylpiperidin-1-yl)-1H-pyrazole-5-carboxamide |
| SMILES | CC1CCCC(C)N1NC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C11H18N4O/c1-8-4-3-5-9(2)15(8)14-11(16)10-6-7-12-13-10/h6-9H,3-5H2,1-2H3,(H,12,13)(H,14,16) |
| InChIKey | WWMSVGAAJKSNPI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |