C11H16N2O — CID 59304520
N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrrole-2-carboxamide (PubChem CID 59304520) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59304520 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclopentyl]-1H-pyrrole-2-carboxamide |
| SMILES | C[C@H]1CCC[C@@H]1NC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C11H16N2O/c1-8-4-2-5-9(8)13-11(14)10-6-3-7-12-10/h3,6-9,12H,2,4-5H2,1H3,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | ZOHUVZKFUZJBJJ-IUCAKERBSA-N |
| XLogP | 1.93 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |