C16H20N4O — CID 120599049
N-(2-methylpiperidin-4-yl)-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 120599049) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 120599049 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CC1CC(NC(=O)c2cc(-c3ccccc3)n[nH]2)CCN1 |
| InChI | InChI=1S/C16H20N4O/c1-11-9-13(7-8-17-11)18-16(21)15-10-14(19-20-15)12-5-3-2-4-6-12/h2-6,10-11,13,17H,7-9H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | XEKSRAZAEBXHNI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |