C24H31FN2O — CID 67357717
N-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]methyl]-2-phenylacetamide (PubChem CID 67357717) has the molecular formula C24H31FN2O and a molecular weight of 382.52 g/mol. Its IUPAC name is N-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]methyl]-2-phenylacetamide.
| Compound Name | N-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 67357717 |
| Molecular Formula | C24H31FN2O |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]methyl]-2-phenylacetamide |
| SMILES | CN(C)C(c1cccc(F)c1)C1CCC(CNC(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H31FN2O/c1-27(2)24(21-9-6-10-22(25)16-21)20-13-11-19(12-14-20)17-26-23(28)15-18-7-4-3-5-8-18/h3-10,16,19-20,24H,11-15,17H2,1-2H3,(H,26,28) |
| InChIKey | PEOJTBGYKDUCSN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |