C27H30FNO3 — CID 175260440
[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl] 2-methyl-5-phenylfuran-3-carboxylate (PubChem CID 175260440) has the molecular formula C27H30FNO3 and a molecular weight of 435.54 g/mol. Its IUPAC name is [4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl] 2-methyl-5-phenylfuran-3-carboxylate.
| Compound Name | [4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl] 2-methyl-5-phenylfuran-3-carboxylate |
|---|---|
| PubChem CID | 175260440 |
| Molecular Formula | C27H30FNO3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl] 2-methyl-5-phenylfuran-3-carboxylate |
| SMILES | Cc1oc(-c2ccccc2)cc1C(=O)OC1CCC(C(c2cccc(F)c2)N(C)C)CC1 |
| InChI | InChI=1S/C27H30FNO3/c1-18-24(17-25(31-18)19-8-5-4-6-9-19)27(30)32-23-14-12-20(13-15-23)26(29(2)3)21-10-7-11-22(28)16-21/h4-11,16-17,20,23,26H,12-15H2,1-3H3 |
| InChIKey | LSYPYZYBGQCMNN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |