C12H15ClN2O4S — CID 61045378
ethyl 2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopropylamino]acetate (PubChem CID 61045378) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopropylamino]acetate.
| Compound Name | ethyl 2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopropylamino]acetate |
|---|---|
| PubChem CID | 61045378 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | ethyl 2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopropylamino]acetate |
| SMILES | CCOC(=O)CN(C1CC1)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C12H15ClN2O4S/c1-2-19-11(16)8-15(9-5-6-9)20(17,18)10-4-3-7-14-12(10)13/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | ISBYYSPYNLYDCS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|