C12H15ClN2O4S — CID 60828632
2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopentylamino]acetic acid (PubChem CID 60828632) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopentylamino]acetic acid.
| Compound Name | 2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopentylamino]acetic acid |
|---|---|
| PubChem CID | 60828632 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)sulfonyl-cyclopentylamino]acetic acid |
| SMILES | O=C(O)CN(C1CCCC1)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C12H15ClN2O4S/c13-12-10(6-3-7-14-12)20(18,19)15(8-11(16)17)9-4-1-2-5-9/h3,6-7,9H,1-2,4-5,8H2,(H,16,17) |
| InChIKey | TYXXSJHDKRDYIZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|