C11H13ClN2O4S — CID 43656189
2-[(2-chloro-3-pyridinyl)sulfonyl-(cyclopropylmethyl)amino]acetic acid (PubChem CID 43656189) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)sulfonyl-(cyclopropylmethyl)amino]acetic acid.
| Compound Name | 2-[(2-chloro-3-pyridinyl)sulfonyl-(cyclopropylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 43656189 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)sulfonyl-(cyclopropylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C11H13ClN2O4S/c12-11-9(2-1-5-13-11)19(17,18)14(7-10(15)16)6-8-3-4-8/h1-2,5,8H,3-4,6-7H2,(H,15,16) |
| InChIKey | BPJQOMCWTQRMKP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|