C9H8ClF3N2O4S — CID 79257826
2-[(2-chloro-3-pyridinyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79257826) has the molecular formula C9H8ClF3N2O4S and a molecular weight of 332.69 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[(2-chloro-3-pyridinyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79257826 |
| Molecular Formula | C9H8ClF3N2O4S |
| Molecular Weight | 332.69 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C9H8ClF3N2O4S/c10-8-6(2-1-3-14-8)20(18,19)15(4-7(16)17)5-9(11,12)13/h1-3H,4-5H2,(H,16,17) |
| InChIKey | QWSLRHPKATZPEX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|