C11H17N3O4S — CID 104710366
ethyl 2-[cyclopropyl-(2-methylpyrazol-3-yl)sulfonylamino]acetate (PubChem CID 104710366) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-(2-methylpyrazol-3-yl)sulfonylamino]acetate.
| Compound Name | ethyl 2-[cyclopropyl-(2-methylpyrazol-3-yl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 104710366 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | ethyl 2-[cyclopropyl-(2-methylpyrazol-3-yl)sulfonylamino]acetate |
| SMILES | CCOC(=O)CN(C1CC1)S(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C11H17N3O4S/c1-3-18-11(15)8-14(9-4-5-9)19(16,17)10-6-7-12-13(10)2/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | QHNHMSPTVAXZLD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |