C12H20N2O4S — CID 55104084
N-(2-aminoethyl)-4,5-dimethoxy-N,2-dimethylbenzenesulfonamide (PubChem CID 55104084) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-(2-aminoethyl)-4,5-dimethoxy-N,2-dimethylbenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-4,5-dimethoxy-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55104084 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-(2-aminoethyl)-4,5-dimethoxy-N,2-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCN)cc1OC |
| InChI | InChI=1S/C12H20N2O4S/c1-9-7-10(17-3)11(18-4)8-12(9)19(15,16)14(2)6-5-13/h7-8H,5-6,13H2,1-4H3 |
| InChIKey | LEGQJYVXVGADBD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |