C11H17NO4S — CID 43164561
4-(2-methoxyethoxy)-2,5-dimethylbenzenesulfonamide (PubChem CID 43164561) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-(2-methoxyethoxy)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43164561 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-(2-methoxyethoxy)-2,5-dimethylbenzenesulfonamide |
| SMILES | COCCOc1cc(C)c(S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C11H17NO4S/c1-8-7-11(17(12,13)14)9(2)6-10(8)16-5-4-15-3/h6-7H,4-5H2,1-3H3,(H2,12,13,14) |
| InChIKey | DRXZZTDPJIPSDU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|