C18H23NO4S — CID 56541458
4,5-dimethoxy-2-methyl-N-phenyl-N-propan-2-ylbenzenesulfonamide (PubChem CID 56541458) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methyl-N-phenyl-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4,5-dimethoxy-2-methyl-N-phenyl-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 56541458 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4,5-dimethoxy-2-methyl-N-phenyl-N-propan-2-ylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(c2ccccc2)C(C)C)cc1OC |
| InChI | InChI=1S/C18H23NO4S/c1-13(2)19(15-9-7-6-8-10-15)24(20,21)18-12-17(23-5)16(22-4)11-14(18)3/h6-13H,1-5H3 |
| InChIKey | DDUYFZBSJIDRCV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |