C32H31NO4S2 — CID 123201233
N-benzylsulfonyl-3-[3-(4-propylnaphthalen-1-yl)oxypropyl]-1-benzothiophene-2-carboxamide (PubChem CID 123201233) has the molecular formula C32H31NO4S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is N-benzylsulfonyl-3-[3-(4-propylnaphthalen-1-yl)oxypropyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-benzylsulfonyl-3-[3-(4-propylnaphthalen-1-yl)oxypropyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 123201233 |
| Molecular Formula | C32H31NO4S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | N-benzylsulfonyl-3-[3-(4-propylnaphthalen-1-yl)oxypropyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCCc1ccc(OCCCc2c(C(=O)NS(=O)(=O)Cc3ccccc3)sc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C32H31NO4S2/c1-2-11-24-19-20-29(26-15-7-6-14-25(24)26)37-21-10-17-28-27-16-8-9-18-30(27)38-31(28)32(34)33-39(35,36)22-23-12-4-3-5-13-23/h3-9,12-16,18-20H,2,10-11,17,21-22H2,1H3,(H,33,34) |
| InChIKey | GJCDNWMXPZVYTG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|