C20H21NOS — CID 110500805
N-(2,3-dimethylphenyl)-3-propyl-1-benzothiophene-2-carboxamide (PubChem CID 110500805) has the molecular formula C20H21NOS and a molecular weight of 323.46 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-3-propyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-3-propyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110500805 |
| Molecular Formula | C20H21NOS |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-(2,3-dimethylphenyl)-3-propyl-1-benzothiophene-2-carboxamide |
| SMILES | CCCc1c(C(=O)Nc2cccc(C)c2C)sc2ccccc12 |
| InChI | InChI=1S/C20H21NOS/c1-4-8-16-15-10-5-6-12-18(15)23-19(16)20(22)21-17-11-7-9-13(2)14(17)3/h5-7,9-12H,4,8H2,1-3H3,(H,21,22) |
| InChIKey | MDIHFJNMGUAJNB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |