C32H32N2O2S2 — CID 144593355
7-(3-methylthiophen-2-yl)-N-phenylsulfanyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide (PubChem CID 144593355) has the molecular formula C32H32N2O2S2 and a molecular weight of 540.75 g/mol. Its IUPAC name is 7-(3-methylthiophen-2-yl)-N-phenylsulfanyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide.
| Compound Name | 7-(3-methylthiophen-2-yl)-N-phenylsulfanyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 144593355 |
| Molecular Formula | C32H32N2O2S2 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 7-(3-methylthiophen-2-yl)-N-phenylsulfanyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccsc1-c1cccc2c(CCCOc3cc(C)c(C)c(C)c3)c(C(=O)NSc3ccccc3)[nH]c12 |
| InChI | InChI=1S/C32H32N2O2S2/c1-20-15-17-37-31(20)28-13-8-12-26-27(14-9-16-36-24-18-21(2)23(4)22(3)19-24)30(33-29(26)28)32(35)34-38-25-10-6-5-7-11-25/h5-8,10-13,15,17-19,33H,9,14,16H2,1-4H3,(H,34,35) |
| InChIKey | FHLKKGDCTYJYPJ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|