C27H23NO4S — CID 130275559
[3-[3-(1-benzothiophen-7-yloxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130275559) has the molecular formula C27H23NO4S and a molecular weight of 457.55 g/mol. Its IUPAC name is [3-[3-(1-benzothiophen-7-yloxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [3-[3-(1-benzothiophen-7-yloxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130275559 |
| Molecular Formula | C27H23NO4S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [3-[3-(1-benzothiophen-7-yloxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1ccccc1-c1cccc2c(CCCOc3cccc4ccsc34)c(OC(=O)O)[nH]c12 |
| InChI | InChI=1S/C27H23NO4S/c1-17-7-2-3-9-19(17)20-10-5-11-21-22(26(28-24(20)21)32-27(29)30)12-6-15-31-23-13-4-8-18-14-16-33-25(18)23/h2-5,7-11,13-14,16,28H,6,12,15H2,1H3,(H,29,30) |
| InChIKey | QBMDXQMGRCDSOP-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|