C32H31NO4 — CID 130275664
[3-(3-naphthalen-1-yloxypropyl)-7-(2,3,5,6-tetramethylphenyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130275664) has the molecular formula C32H31NO4 and a molecular weight of 493.60 g/mol. Its IUPAC name is [3-(3-naphthalen-1-yloxypropyl)-7-(2,3,5,6-tetramethylphenyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [3-(3-naphthalen-1-yloxypropyl)-7-(2,3,5,6-tetramethylphenyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130275664 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | [3-(3-naphthalen-1-yloxypropyl)-7-(2,3,5,6-tetramethylphenyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1cc(C)c(C)c(-c2cccc3c(CCCOc4cccc5ccccc45)c(OC(=O)O)[nH]c23)c1C |
| InChI | InChI=1S/C32H31NO4/c1-19-18-20(2)22(4)29(21(19)3)27-14-8-13-25-26(31(33-30(25)27)37-32(34)35)15-9-17-36-28-16-7-11-23-10-5-6-12-24(23)28/h5-8,10-14,16,18,33H,9,15,17H2,1-4H3,(H,34,35) |
| InChIKey | QUEGKCGDXDINPR-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|