C28H22ClNO4 — CID 130274445
[7-(2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130274445) has the molecular formula C28H22ClNO4 and a molecular weight of 471.94 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-(2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130274445 |
| Molecular Formula | C28H22ClNO4 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | [7-(2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1[nH]c2c(-c3ccccc3Cl)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C28H22ClNO4/c29-24-15-4-3-11-20(24)21-12-6-13-22-23(27(30-26(21)22)34-28(31)32)14-7-17-33-25-16-5-9-18-8-1-2-10-19(18)25/h1-6,8-13,15-16,30H,7,14,17H2,(H,31,32) |
| InChIKey | YACUGCDKFOIXTP-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|