C36H34N4O4 — CID 118394971
3-[[1-methyl-3-(3-naphthalen-1-yloxypropyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]amino]benzoic acid (PubChem CID 118394971) has the molecular formula C36H34N4O4 and a molecular weight of 586.69 g/mol. Its IUPAC name is 3-[[1-methyl-3-(3-naphthalen-1-yloxypropyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[1-methyl-3-(3-naphthalen-1-yloxypropyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 118394971 |
| Molecular Formula | C36H34N4O4 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 3-[[1-methyl-3-(3-naphthalen-1-yloxypropyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]amino]benzoic acid |
| SMILES | Cc1nn(C)c(C)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)Nc3cccc(C(=O)O)c3)n(C)c12 |
| InChI | InChI=1S/C36H34N4O4/c1-22-32(23(2)40(4)38-22)30-17-9-16-28-29(18-10-20-44-31-19-8-12-24-11-5-6-15-27(24)31)34(39(3)33(28)30)35(41)37-26-14-7-13-25(21-26)36(42)43/h5-9,11-17,19,21H,10,18,20H2,1-4H3,(H,37,41)(H,42,43) |
| InChIKey | FPISBXJPYHDUDL-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|