C38H41N3O6 — CID 146444222
(10Z)-5-methyl-15-(3-naphthalen-1-yloxypropyl)-3-[2-(oxan-2-yloxy)ethyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaene-14-carboxylic acid (PubChem CID 146444222) has the molecular formula C38H41N3O6 and a molecular weight of 635.76 g/mol. Its IUPAC name is (10Z)-5-methyl-15-(3-naphthalen-1-yloxypropyl)-3-[2-(oxan-2-yloxy)ethyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaene-14-carboxylic acid.
| Compound Name | (10Z)-5-methyl-15-(3-naphthalen-1-yloxypropyl)-3-[2-(oxan-2-yloxy)ethyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaene-14-carboxylic acid |
|---|---|
| PubChem CID | 146444222 |
| Molecular Formula | C38H41N3O6 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | (10Z)-5-methyl-15-(3-naphthalen-1-yloxypropyl)-3-[2-(oxan-2-yloxy)ethyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaene-14-carboxylic acid |
| SMILES | Cn1nc(CCOC2CCCCO2)c2c1COC/C=C\Cn1c(C(=O)O)c(CCCOc3cccc4ccccc34)c3cccc-2c31 |
| InChI | InChI=1S/C38H41N3O6/c1-40-32-25-44-21-7-5-20-41-36-28(14-9-15-30(36)35(32)31(39-40)19-24-47-34-18-4-6-22-46-34)29(37(41)38(42)43)16-10-23-45-33-17-8-12-26-11-2-3-13-27(26)33/h2-3,5,7-9,11-15,17,34H,4,6,10,16,18-25H2,1H3,(H,42,43)/b7-5- |
| InChIKey | HZMLOIPSLXZTEG-ALCCZGGFSA-N |
| XLogP | 7.08 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|