C36H43FN4O4 — CID 160860535
N-ethylethanamine;15-[3-(4-fluoronaphthalen-1-yl)oxypropyl]-3,5-dimethyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 160860535) has the molecular formula C36H43FN4O4 and a molecular weight of 614.76 g/mol. Its IUPAC name is N-ethylethanamine;15-[3-(4-fluoronaphthalen-1-yl)oxypropyl]-3,5-dimethyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | N-ethylethanamine;15-[3-(4-fluoronaphthalen-1-yl)oxypropyl]-3,5-dimethyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 160860535 |
| Molecular Formula | C36H43FN4O4 |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | N-ethylethanamine;15-[3-(4-fluoronaphthalen-1-yl)oxypropyl]-3,5-dimethyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCNCC.Cc1nn(C)c2c1-c1cccc3c(CCCOc4ccc(F)c5ccccc45)c(C(=O)O)n(c13)CCCCOC2 |
| InChI | InChI=1S/C32H32FN3O4.C4H11N/c1-20-29-25-12-7-11-23-24(13-8-18-40-28-15-14-26(33)21-9-3-4-10-22(21)28)31(32(37)38)36(30(23)25)16-5-6-17-39-19-27(29)35(2)34-20;1-3-5-4-2/h3-4,7,9-12,14-15H,5-6,8,13,16-19H2,1-2H3,(H,37,38);5H,3-4H2,1-2H3 |
| InChIKey | SKKNRDBNRUCZOR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|