C37H46N4O5 — CID 160634893
N-ethylethanamine;19-methoxy-3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 160634893) has the molecular formula C37H46N4O5 and a molecular weight of 626.80 g/mol. Its IUPAC name is N-ethylethanamine;19-methoxy-3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | N-ethylethanamine;19-methoxy-3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 160634893 |
| Molecular Formula | C37H46N4O5 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | N-ethylethanamine;19-methoxy-3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCNCC.COc1ccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)n3c2c1-c1c(nn(C)c1C)COCCCC3 |
| InChI | InChI=1S/C33H35N3O5.C4H11N/c1-21-29-26(34-35(21)2)20-40-18-7-6-17-36-31-25(15-16-28(39-3)30(29)31)24(32(36)33(37)38)13-9-19-41-27-14-8-11-22-10-4-5-12-23(22)27;1-3-5-4-2/h4-5,8,10-12,14-16H,6-7,9,13,17-20H2,1-3H3,(H,37,38);5H,3-4H2,1-2H3 |
| InChIKey | RIKHMZHMIXFXEO-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|