C33H38FN3O4 — CID 142591479
3-ethyl-19-fluoro-5-methyl-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591479) has the molecular formula C33H38FN3O4 and a molecular weight of 559.68 g/mol. Its IUPAC name is 3-ethyl-19-fluoro-5-methyl-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 3-ethyl-19-fluoro-5-methyl-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591479 |
| Molecular Formula | C33H38FN3O4 |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 3-ethyl-19-fluoro-5-methyl-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCc1nn(C)c2c1-c1c(F)ccc3c(CCCOc4cccc5c4CCCC5)c(C(=O)O)n(c13)CCCCOC2 |
| InChI | InChI=1S/C33H38FN3O4/c1-3-26-30-27(36(2)35-26)20-40-18-7-6-17-37-31-24(15-16-25(34)29(30)31)23(32(37)33(38)39)13-9-19-41-28-14-8-11-21-10-4-5-12-22(21)28/h8,11,14-16H,3-7,9-10,12-13,17-20H2,1-2H3,(H,38,39) |
| InChIKey | GVABTUFPIIQHMZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|