C33H39FN4O3 — CID 142591507
15-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-3-ethyl-19-fluoro-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591507) has the molecular formula C33H39FN4O3 and a molecular weight of 558.70 g/mol. Its IUPAC name is 15-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-3-ethyl-19-fluoro-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 15-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-3-ethyl-19-fluoro-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591507 |
| Molecular Formula | C33H39FN4O3 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 15-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-3-ethyl-19-fluoro-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCc1c2c(nn1C)CN(C)CCCCn1c(C(=O)O)c(CCCOc3cccc4c3CCC4)c3ccc(F)c-2c31 |
| InChI | InChI=1S/C33H39FN4O3/c1-4-27-30-26(35-37(27)3)20-36(2)17-5-6-18-38-31-24(15-16-25(34)29(30)31)23(32(38)33(39)40)13-9-19-41-28-14-8-11-21-10-7-12-22(21)28/h8,11,14-16H,4-7,9-10,12-13,17-20H2,1-3H3,(H,39,40) |
| InChIKey | LMTGRBLZXQQTBR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|