C35H39FN4O3 — CID 142591522
ethyl 3-ethyl-19-fluoro-8-methyl-15-(3-naphthalen-1-yloxypropyl)-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate (PubChem CID 142591522) has the molecular formula C35H39FN4O3 and a molecular weight of 582.72 g/mol. Its IUPAC name is ethyl 3-ethyl-19-fluoro-8-methyl-15-(3-naphthalen-1-yloxypropyl)-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate.
| Compound Name | ethyl 3-ethyl-19-fluoro-8-methyl-15-(3-naphthalen-1-yloxypropyl)-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 142591522 |
| Molecular Formula | C35H39FN4O3 |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | ethyl 3-ethyl-19-fluoro-8-methyl-15-(3-naphthalen-1-yloxypropyl)-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2ccc(F)c3c2n1CCCCN(C)Cc1[nH]nc(CC)c1-3 |
| InChI | InChI=1S/C35H39FN4O3/c1-4-28-32-29(38-37-28)22-39(3)19-8-9-20-40-33-26(17-18-27(36)31(32)33)25(34(40)35(41)42-5-2)15-11-21-43-30-16-10-13-23-12-6-7-14-24(23)30/h6-7,10,12-14,16-18H,4-5,8-9,11,15,19-22H2,1-3H3,(H,37,38) |
| InChIKey | DSERIWKFOZBCFX-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|