C33H35FN4O — CID 142591532
19-fluoro-3-methyl-15-(3-naphthalen-1-yloxypropyl)-14-prop-1-en-2-yl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene (PubChem CID 142591532) has the molecular formula C33H35FN4O and a molecular weight of 522.67 g/mol. Its IUPAC name is 19-fluoro-3-methyl-15-(3-naphthalen-1-yloxypropyl)-14-prop-1-en-2-yl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene.
| Compound Name | 19-fluoro-3-methyl-15-(3-naphthalen-1-yloxypropyl)-14-prop-1-en-2-yl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene |
|---|---|
| PubChem CID | 142591532 |
| Molecular Formula | C33H35FN4O |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 19-fluoro-3-methyl-15-(3-naphthalen-1-yloxypropyl)-14-prop-1-en-2-yl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene |
| SMILES | C=C(C)c1c(CCCOc2cccc3ccccc23)c2ccc(F)c3c2n1CCCCNCc1n[nH]c(C)c1-3 |
| InChI | InChI=1S/C33H35FN4O/c1-21(2)32-25(13-9-19-39-29-14-8-11-23-10-4-5-12-24(23)29)26-15-16-27(34)31-30-22(3)36-37-28(30)20-35-17-6-7-18-38(32)33(26)31/h4-5,8,10-12,14-16,35H,1,6-7,9,13,17-20H2,2-3H3,(H,36,37) |
| InChIKey | QJVQORGKIDSEPZ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|