C34H39N4O3+ — CID 165069293
ethyl 3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-5,8,13-triaza-4-azoniatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate (PubChem CID 165069293) has the molecular formula C34H39N4O3+ and a molecular weight of 551.71 g/mol. Its IUPAC name is ethyl 3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-5,8,13-triaza-4-azoniatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate.
| Compound Name | ethyl 3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-5,8,13-triaza-4-azoniatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 165069293 |
| Molecular Formula | C34H39N4O3+ |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | ethyl 3,4-dimethyl-15-(3-naphthalen-1-yloxypropyl)-5,8,13-triaza-4-azoniatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2cccc3c2n1CCCCNCc1[nH][n+](C)c(C)c1-3 |
| InChI | InChI=1S/C34H38N4O3/c1-4-40-34(39)33-27(17-11-21-41-30-18-9-13-24-12-5-6-14-25(24)30)26-15-10-16-28-31-23(2)37(3)36-29(31)22-35-19-7-8-20-38(33)32(26)28/h5-6,9-10,12-16,18,35H,4,7-8,11,17,19-22H2,1-3H3/p+1 |
| InChIKey | SMKFSAJUIARWMC-UHFFFAOYSA-O |
| XLogP | 5.99 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|