C32H34N4O5S — CID 142591712
3-ethyl-4-methyl-15-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591712) has the molecular formula C32H34N4O5S and a molecular weight of 586.71 g/mol. Its IUPAC name is 3-ethyl-4-methyl-15-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 3-ethyl-4-methyl-15-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591712 |
| Molecular Formula | C32H34N4O5S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 3-ethyl-4-methyl-15-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCc1c2c(nn1C)CNS(=O)(=O)CCCn1c(C(=O)O)c(CCCOc3cccc4ccccc34)c3cccc-2c31 |
| InChI | InChI=1S/C32H34N4O5S/c1-3-27-29-25-14-7-13-23-24(15-8-18-41-28-16-6-11-21-10-4-5-12-22(21)28)31(32(37)38)36(30(23)25)17-9-19-42(39,40)33-20-26(29)34-35(27)2/h4-7,10-14,16,33H,3,8-9,15,17-20H2,1-2H3,(H,37,38) |
| InChIKey | WSCLIUZENSUOMD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|