C32H32F2N4O5S — CID 142591560
19-fluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591560) has the molecular formula C32H32F2N4O5S and a molecular weight of 622.69 g/mol. Its IUPAC name is 19-fluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 19-fluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591560 |
| Molecular Formula | C32H32F2N4O5S |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 19-fluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | Cc1c2c(nn1C)CN(C)S(=O)(=O)CCCn1c(C(=O)O)c(CCCOc3cccc4cc(F)ccc34)c3ccc(F)c-2c31 |
| InChI | InChI=1S/C32H32F2N4O5S/c1-19-28-26(35-37(19)3)18-36(2)44(41,42)16-6-14-38-30-24(12-13-25(34)29(28)30)23(31(38)32(39)40)8-5-15-43-27-9-4-7-20-17-21(33)10-11-22(20)27/h4,7,9-13,17H,5-6,8,14-16,18H2,1-3H3,(H,39,40) |
| InChIKey | SFAUIQOMBNEQSP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|