C36H40ClFN4O3 — CID 142591087
ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate (PubChem CID 142591087) has the molecular formula C36H40ClFN4O3 and a molecular weight of 631.19 g/mol. Its IUPAC name is ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate.
| Compound Name | ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 142591087 |
| Molecular Formula | C36H40ClFN4O3 |
| Molecular Weight | 631.19 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3cc(F)ccc23)c2ccc(Cl)c3c2n1CCCCN(C)Cc1nn(C)c(CC)c1-3 |
| InChI | InChI=1S/C36H40ClFN4O3/c1-5-30-33-29(39-41(30)4)22-40(3)18-7-8-19-42-34-27(16-17-28(37)32(33)34)26(35(42)36(43)44-6-2)12-10-20-45-31-13-9-11-23-21-24(38)14-15-25(23)31/h9,11,13-17,21H,5-8,10,12,18-20,22H2,1-4H3 |
| InChIKey | SRNQQTOTRNWSMI-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 61.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.19 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|