C41H41ClFN3O4 — CID 142591834
ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-7-phenyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate (PubChem CID 142591834) has the molecular formula C41H41ClFN3O4 and a molecular weight of 694.25 g/mol. Its IUPAC name is ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-7-phenyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate.
| Compound Name | ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-7-phenyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 142591834 |
| Molecular Formula | C41H41ClFN3O4 |
| Molecular Weight | 694.25 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | ethyl 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-7-phenyl-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3cc(F)ccc23)c2ccc(Cl)c3c2n1CCCCOC(c1ccccc1)c1nn(C)c(CC)c1-3 |
| InChI | InChI=1S/C41H41ClFN3O4/c1-4-33-36-35-32(42)21-20-31-30(16-12-24-49-34-17-11-15-27-25-28(43)18-19-29(27)34)39(41(47)48-5-2)46(38(31)35)22-9-10-23-50-40(37(36)44-45(33)3)26-13-7-6-8-14-26/h6-8,11,13-15,17-21,25,40H,4-5,9-10,12,16,22-24H2,1-3H3 |
| InChIKey | BIJIFOJRGZOQSC-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.25 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|