C35H40ClFN4O3 — CID 166724696
[19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol (PubChem CID 166724696) has the molecular formula C35H40ClFN4O3 and a molecular weight of 619.18 g/mol. Its IUPAC name is [19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol.
| Compound Name | [19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 166724696 |
| Molecular Formula | C35H40ClFN4O3 |
| Molecular Weight | 619.18 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | [19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol |
| SMILES | CCOC(O)c1c(CCCOc2cccc3cc(F)ccc23)c2ccc(Cl)c3c2n1CCCCNCc1nn(C)c(CC)c1-3 |
| InChI | InChI=1S/C35H40ClFN4O3/c1-4-29-32-28(39-40(29)3)21-38-17-6-7-18-41-33-26(15-16-27(36)31(32)33)25(34(41)35(42)43-5-2)11-9-19-44-30-12-8-10-22-20-23(37)13-14-24(22)30/h8,10,12-16,20,35,38,42H,4-7,9,11,17-19,21H2,1-3H3 |
| InChIKey | FTMDQFZTHZAYER-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.18 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|