C35H40ClFN4O3 — CID 166724676
[19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,7-trimethyl-4,5,7,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol (PubChem CID 166724676) has the molecular formula C35H40ClFN4O3 and a molecular weight of 619.18 g/mol. Its IUPAC name is [19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,7-trimethyl-4,5,7,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol.
| Compound Name | [19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,7-trimethyl-4,5,7,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 166724676 |
| Molecular Formula | C35H40ClFN4O3 |
| Molecular Weight | 619.18 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | [19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,7-trimethyl-4,5,7,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaen-14-yl]-ethoxymethanol |
| SMILES | CCOC(O)c1c(CCCOc2cccc3cc(F)ccc23)c2ccc(Cl)c3c2n1CCCCCN(C)c1nn(C)c(C)c1-3 |
| InChI | InChI=1S/C35H40ClFN4O3/c1-5-43-35(42)33-26(12-10-20-44-29-13-9-11-23-21-24(37)14-15-25(23)29)27-16-17-28(36)31-30-22(2)40(4)38-34(30)39(3)18-7-6-8-19-41(33)32(27)31/h9,11,13-17,21,35,42H,5-8,10,12,18-20H2,1-4H3 |
| InChIKey | JOWVZRUPXLOMHR-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.18 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|