C33H34ClFN4O3 — CID 142591246
19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591246) has the molecular formula C33H34ClFN4O3 and a molecular weight of 589.11 g/mol. Its IUPAC name is 19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591246 |
| Molecular Formula | C33H34ClFN4O3 |
| Molecular Weight | 589.11 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 19-chloro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-3,4,8-trimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | Cc1c2c(nn1C)CN(C)CCCCn1c(C(=O)O)c(CCCOc3cccc4cc(F)ccc34)c3ccc(Cl)c-2c31 |
| InChI | InChI=1S/C33H34ClFN4O3/c1-20-29-27(36-38(20)3)19-37(2)15-4-5-16-39-31-25(13-14-26(34)30(29)31)24(32(39)33(40)41)9-7-17-42-28-10-6-8-21-18-22(35)11-12-23(21)28/h6,8,10-14,18H,4-5,7,9,15-17,19H2,1-3H3,(H,40,41) |
| InChIKey | OGHDOPFGJXKBFT-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.11 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|