C32H34FN3O2 — CID 167149183
3-ethyl-19-fluoro-14-methyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene (PubChem CID 167149183) has the molecular formula C32H34FN3O2 and a molecular weight of 511.64 g/mol. Its IUPAC name is 3-ethyl-19-fluoro-14-methyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene.
| Compound Name | 3-ethyl-19-fluoro-14-methyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene |
|---|---|
| PubChem CID | 167149183 |
| Molecular Formula | C32H34FN3O2 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 3-ethyl-19-fluoro-14-methyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene |
| SMILES | CCc1n[nH]c2c1-c1c(F)ccc3c(CCCOc4cccc5ccccc45)c(C)n(c13)CCCCOC2 |
| InChI | InChI=1S/C32H34FN3O2/c1-3-27-31-28(35-34-27)20-37-18-7-6-17-36-21(2)23(25-15-16-26(33)30(31)32(25)36)13-9-19-38-29-14-8-11-22-10-4-5-12-24(22)29/h4-5,8,10-12,14-16H,3,6-7,9,13,17-20H2,1-2H3,(H,34,35) |
| InChIKey | BYWHIGZGUSRGMM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|