C34H40FN3O4 — CID 156654915
ethyl 3-ethyl-19-fluoro-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate (PubChem CID 156654915) has the molecular formula C34H40FN3O4 and a molecular weight of 573.71 g/mol. Its IUPAC name is ethyl 3-ethyl-19-fluoro-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate.
| Compound Name | ethyl 3-ethyl-19-fluoro-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 156654915 |
| Molecular Formula | C34H40FN3O4 |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | ethyl 3-ethyl-19-fluoro-15-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,14,16(20),17-hexaene-14-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3c2CCCC3)c2ccc(F)c3c2n1CCCCOCc1[nH]nc(CC)c1-3 |
| InChI | InChI=1S/C34H40FN3O4/c1-3-27-31-28(37-36-27)21-40-19-8-7-18-38-32-25(16-17-26(35)30(31)32)24(33(38)34(39)41-4-2)14-10-20-42-29-15-9-12-22-11-5-6-13-23(22)29/h9,12,15-17H,3-8,10-11,13-14,18-21H2,1-2H3,(H,36,37) |
| InChIKey | FWUVRVFKQXXKEF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|