C34H36FN3O4 — CID 167149206
ethoxy-[(10Z)-19-fluoro-3,5-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaen-14-yl]methanol (PubChem CID 167149206) has the molecular formula C34H36FN3O4 and a molecular weight of 569.68 g/mol. Its IUPAC name is ethoxy-[(10Z)-19-fluoro-3,5-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaen-14-yl]methanol.
| Compound Name | ethoxy-[(10Z)-19-fluoro-3,5-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaen-14-yl]methanol |
|---|---|
| PubChem CID | 167149206 |
| Molecular Formula | C34H36FN3O4 |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | ethoxy-[(10Z)-19-fluoro-3,5-dimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2(6),3,10,14,16(20),17-heptaen-14-yl]methanol |
| SMILES | CCOC(O)c1c(CCCOc2cccc3ccccc23)c2ccc(F)c3c2n1C/C=C\COCc1c-3c(C)nn1C |
| InChI | InChI=1S/C34H36FN3O4/c1-4-41-34(39)33-25(14-10-20-42-29-15-9-12-23-11-5-6-13-24(23)29)26-16-17-27(35)31-30-22(2)36-37(3)28(30)21-40-19-8-7-18-38(33)32(26)31/h5-9,11-13,15-17,34,39H,4,10,14,18-21H2,1-3H3/b8-7- |
| InChIKey | ZBPXXANQEKYYFC-FPLPWBNLSA-N |
| XLogP | 6.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|