C29H36ClN3O2S — CID 144800756
3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1-methylpyrrol-2-yl)indol-1-yl]propanamide;methanethiol (PubChem CID 144800756) has the molecular formula C29H36ClN3O2S and a molecular weight of 526.15 g/mol. Its IUPAC name is 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1-methylpyrrol-2-yl)indol-1-yl]propanamide;methanethiol.
| Compound Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1-methylpyrrol-2-yl)indol-1-yl]propanamide;methanethiol |
|---|---|
| PubChem CID | 144800756 |
| Molecular Formula | C29H36ClN3O2S |
| Molecular Weight | 526.15 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1-methylpyrrol-2-yl)indol-1-yl]propanamide;methanethiol |
| SMILES | CS.Cc1cc(OCCCc2c(C)n(CCC(N)=O)c3c(-c4cccn4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C28H32ClN3O2.CH4S/c1-18-16-21(17-19(2)27(18)29)34-15-7-10-22-20(3)32(14-12-26(30)33)28-23(22)8-5-9-24(28)25-11-6-13-31(25)4;1-2/h5-6,8-9,11,13,16-17H,7,10,12,14-15H2,1-4H3,(H2,30,33);2H,1H3 |
| InChIKey | GJVKIIYLHXCFHZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.15 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|