C38H53ClN4O2S — CID 144800778
3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]propanamide;ethane;(3E)-hexa-1,3-diene-3-thiol (PubChem CID 144800778) has the molecular formula C38H53ClN4O2S and a molecular weight of 665.39 g/mol. Its IUPAC name is 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]propanamide;ethane;(3E)-hexa-1,3-diene-3-thiol.
| Compound Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]propanamide;ethane;(3E)-hexa-1,3-diene-3-thiol |
|---|---|
| PubChem CID | 144800778 |
| Molecular Formula | C38H53ClN4O2S |
| Molecular Weight | 665.39 g/mol |
| Exact Mass | 664.36 |
| IUPAC Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]propanamide;ethane;(3E)-hexa-1,3-diene-3-thiol |
| SMILES | C=C/C(S)=C\CC.CC.CCn1nc(C)c(-c2cccc3c(CCCOc4cc(C)c(Cl)c(C)c4)c(C)n(CCC(N)=O)c23)c1C |
| InChI | InChI=1S/C30H37ClN4O2.C6H10S.C2H6/c1-7-35-22(6)28(20(4)33-35)26-11-8-10-25-24(21(5)34(30(25)26)14-13-27(32)36)12-9-15-37-23-16-18(2)29(31)19(3)17-23;1-3-5-6(7)4-2;1-2/h8,10-11,16-17H,7,9,12-15H2,1-6H3,(H2,32,36);4-5,7H,2-3H2,1H3;1-2H3/b;6-5+; |
| InChIKey | ZWKNTSDIXIQGFO-AUNBPGBOSA-N |
| XLogP | 10.03 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.39 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|