C32H34Cl2N4O5 — CID 158443929
2-[[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]azetidin-3-yl]amino]-2-oxoacetic acid (PubChem CID 158443929) has the molecular formula C32H34Cl2N4O5 and a molecular weight of 625.55 g/mol. Its IUPAC name is 2-[[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]azetidin-3-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]azetidin-3-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 158443929 |
| Molecular Formula | C32H34Cl2N4O5 |
| Molecular Weight | 625.55 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 2-[[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]azetidin-3-yl]amino]-2-oxoacetic acid |
| SMILES | Cc1cc(OCCCC2=C(C(=O)N3CC(NC(=O)C(=O)O)C3)Cc3c2ccc(Cl)c3-c2c(C)nn(C)c2C)cc(C)c1Cl |
| InChI | InChI=1S/C32H34Cl2N4O5/c1-16-11-21(12-17(2)29(16)34)43-10-6-7-22-23-8-9-26(33)28(27-18(3)36-37(5)19(27)4)24(23)13-25(22)31(40)38-14-20(15-38)35-30(39)32(41)42/h8-9,11-12,20H,6-7,10,13-15H2,1-5H3,(H,35,39)(H,41,42) |
| InChIKey | HDDQKRXYIIHDSJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|