C34H39Cl2N3O4 — CID 159274552
[(1R,2S)-2-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]amino]cyclohexyl] formate (PubChem CID 159274552) has the molecular formula C34H39Cl2N3O4 and a molecular weight of 624.61 g/mol. Its IUPAC name is [(1R,2S)-2-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]amino]cyclohexyl] formate.
| Compound Name | [(1R,2S)-2-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]amino]cyclohexyl] formate |
|---|---|
| PubChem CID | 159274552 |
| Molecular Formula | C34H39Cl2N3O4 |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | [(1R,2S)-2-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carbonyl]amino]cyclohexyl] formate |
| SMILES | Cc1cc(OCCCC2=C(C(=O)N[C@H]3CCCC[C@H]3OC=O)Cc3c2ccc(Cl)c3-c2c(C)nn(C)c2C)cc(C)c1Cl |
| InChI | InChI=1S/C34H39Cl2N3O4/c1-19-15-23(16-20(2)33(19)36)42-14-8-9-24-25-12-13-28(35)32(31-21(3)38-39(5)22(31)4)26(25)17-27(24)34(41)37-29-10-6-7-11-30(29)43-18-40/h12-13,15-16,18,29-30H,6-11,14,17H2,1-5H3,(H,37,41)/t29-,30+/m0/s1 |
| InChIKey | KYDCXXKKNAYOOP-XZWHSSHBSA-N |
| XLogP | 7.40 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|