C41H52N4O6 — CID 167040419
ethyl 7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1-[4-[methyl-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate (PubChem CID 167040419) has the molecular formula C41H52N4O6 and a molecular weight of 696.89 g/mol. Its IUPAC name is ethyl 7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1-[4-[methyl-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate.
| Compound Name | ethyl 7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1-[4-[methyl-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 167040419 |
| Molecular Formula | C41H52N4O6 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 696.39 |
| IUPAC Name | ethyl 7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1-[4-[methyl-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2cccc(-c3c(CO)nn(C)c3C)c2n1CCCCN(C)C1OC1OC(C)(C)C |
| InChI | InChI=1S/C41H52N4O6/c1-8-48-39(47)37-31(21-15-25-49-34-22-13-17-28-16-9-10-18-29(28)34)30-19-14-20-32(35-27(2)44(7)42-33(35)26-46)36(30)45(37)24-12-11-23-43(6)38-40(50-38)51-41(3,4)5/h9-10,13-14,16-20,22,38,40,46H,8,11-12,15,21,23-26H2,1-7H3 |
| InChIKey | ZPYVVXIEQMRELG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|