C46H52BrN5O5 — CID 166155261
tert-butyl 7-[3-[(4-bromo-3-formylphenoxy)methyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate (PubChem CID 166155261) has the molecular formula C46H52BrN5O5 and a molecular weight of 834.86 g/mol. Its IUPAC name is tert-butyl 7-[3-[(4-bromo-3-formylphenoxy)methyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate.
| Compound Name | tert-butyl 7-[3-[(4-bromo-3-formylphenoxy)methyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 166155261 |
| Molecular Formula | C46H52BrN5O5 |
| Molecular Weight | 834.86 g/mol |
| Exact Mass | 833.32 |
| IUPAC Name | tert-butyl 7-[3-[(4-bromo-3-formylphenoxy)methyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
| SMILES | Cc1c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)OC(C)(C)C)n(CCN4CCN(C)CC4)c23)c(COc2ccc(Br)c(C=O)c2)nn1C |
| InChI | InChI=1S/C46H52BrN5O5/c1-31-42(40(48-50(31)6)30-56-34-19-20-39(47)33(28-34)29-53)38-16-10-15-36-37(17-11-27-55-41-18-9-13-32-12-7-8-14-35(32)41)44(45(54)57-46(2,3)4)52(43(36)38)26-25-51-23-21-49(5)22-24-51/h7-10,12-16,18-20,28-29H,11,17,21-27,30H2,1-6H3 |
| InChIKey | JBICVBSOXBRXIM-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 91.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.86 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|