C26H29ClN2O3 — CID 175730080
1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid;hydrochloride (PubChem CID 175730080) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is 1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid;hydrochloride.
| Compound Name | 1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 175730080 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid;hydrochloride |
| SMILES | CNCCCn1c(C(=O)O)c(CCCOc2cccc3ccccc23)c2ccccc21.Cl |
| InChI | InChI=1S/C26H28N2O3.ClH/c1-27-16-8-17-28-23-14-5-4-12-21(23)22(25(28)26(29)30)13-7-18-31-24-15-6-10-19-9-2-3-11-20(19)24;/h2-6,9-12,14-15,27H,7-8,13,16-18H2,1H3,(H,29,30);1H |
| InChIKey | AIYHESRVDYVUTP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|