C29H25NO5 — CID 25099970
1-[(4-methoxyphenyl)methyl]-3-(2-naphthalen-1-yloxyethoxy)indole-2-carboxylic acid (PubChem CID 25099970) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-(2-naphthalen-1-yloxyethoxy)indole-2-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-(2-naphthalen-1-yloxyethoxy)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25099970 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-(2-naphthalen-1-yloxyethoxy)indole-2-carboxylic acid |
| SMILES | COc1ccc(Cn2c(C(=O)O)c(OCCOc3cccc4ccccc34)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H25NO5/c1-33-22-15-13-20(14-16-22)19-30-25-11-5-4-10-24(25)28(27(30)29(31)32)35-18-17-34-26-12-6-8-21-7-2-3-9-23(21)26/h2-16H,17-19H2,1H3,(H,31,32) |
| InChIKey | WBWXOUBFGMTXGH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|