C30H23NO4 — CID 25099971
1-[(4-methoxyphenyl)methyl]-3-(3-naphthalen-1-yloxyprop-1-ynyl)indole-2-carboxylic acid (PubChem CID 25099971) has the molecular formula C30H23NO4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-(3-naphthalen-1-yloxyprop-1-ynyl)indole-2-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-(3-naphthalen-1-yloxyprop-1-ynyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25099971 |
| Molecular Formula | C30H23NO4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-(3-naphthalen-1-yloxyprop-1-ynyl)indole-2-carboxylic acid |
| SMILES | COc1ccc(Cn2c(C(=O)O)c(C#CCOc3cccc4ccccc34)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H23NO4/c1-34-23-17-15-21(16-18-23)20-31-27-13-5-4-11-25(27)26(29(31)30(32)33)12-7-19-35-28-14-6-9-22-8-2-3-10-24(22)28/h2-6,8-11,13-18H,19-20H2,1H3,(H,32,33) |
| InChIKey | JWPKUCVBBYZSQE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|